C23H19N3O5S — CID 124866741
ethyl (7R)-5-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-7-phenyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124866741) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is ethyl (7R)-5-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-7-phenyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (7R)-5-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-7-phenyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124866741 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethyl (7R)-5-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-7-phenyl-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)n2c(sc(=Cc3cccc([N+](=O)[O-])c3)c2=O)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H19N3O5S/c1-3-31-22(28)19-14(2)25-21(27)18(13-15-8-7-11-17(12-15)26(29)30)32-23(25)24-20(19)16-9-5-4-6-10-16/h4-13,20H,3H2,1-2H3/t20-/m1/s1 |
| InChIKey | HUSRKJFHMLINOV-HXUWFJFHSA-N |
| XLogP | 2.82 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|