C31H27N3O7S — CID 126338802
ethyl (2Z,7R)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126338802) has the molecular formula C31H27N3O7S and a molecular weight of 585.64 g/mol. Its IUPAC name is ethyl (2Z,7R)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,7R)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126338802 |
| Molecular Formula | C31H27N3O7S |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | ethyl (2Z,7R)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)n2c(s/c(=C\c3ccccc3[N+](=O)[O-])c2=O)=N[C@@H]1c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C31H27N3O7S/c1-4-40-30(36)27-19(2)33-29(35)26(17-21-12-8-9-13-23(21)34(37)38)42-31(33)32-28(27)22-14-15-24(25(16-22)39-3)41-18-20-10-6-5-7-11-20/h5-17,28H,4,18H2,1-3H3/b26-17-/t28-/m1/s1 |
| InChIKey | LIOAMSKPUDLXRK-YNMQQHPQSA-N |
| XLogP | 4.40 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|