C26H25N3O9S — CID 171155158
acetic acid;ethyl 7-(4-hydroxy-3-methoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 171155158) has the molecular formula C26H25N3O9S and a molecular weight of 555.57 g/mol. Its IUPAC name is acetic acid;ethyl 7-(4-hydroxy-3-methoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | acetic acid;ethyl 7-(4-hydroxy-3-methoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 171155158 |
| Molecular Formula | C26H25N3O9S |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | acetic acid;ethyl 7-(4-hydroxy-3-methoxyphenyl)-5-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CC(=O)O.CCOC(=O)C1=C(C)n2c(sc(=Cc3ccccc3[N+](=O)[O-])c2=O)=NC1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C24H21N3O7S.C2H4O2/c1-4-34-23(30)20-13(2)26-22(29)19(12-14-7-5-6-8-16(14)27(31)32)35-24(26)25-21(20)15-9-10-17(28)18(11-15)33-3;1-2(3)4/h5-12,21,28H,4H2,1-3H3;1H3,(H,3,4) |
| InChIKey | PVYABPRWZOLXBY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 170.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|