C16H13ClN2O5S2 — CID 5351418
ethyl (2Z)-5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-6-carboxylate chloride (PubChem CID 5351418) has the molecular formula C16H13ClN2O5S2 and a molecular weight of 412.88 g/mol. Its IUPAC name is ethyl (2Z)-5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-6-carboxylate chloride.
| Compound Name | ethyl (2Z)-5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-6-carboxylate chloride |
|---|---|
| PubChem CID | 5351418 |
| Molecular Formula | C16H13ClN2O5S2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | ethyl (2Z)-5-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-6-carboxylate chloride |
| SMILES | CCOC(=O)c1sc2[n+](c1C)C(=O)/C(=C/c1ccc([N+](=O)[O-])cc1)S2.[Cl-] |
| InChI | InChI=1S/C16H13N2O5S2.ClH/c1-3-23-15(20)13-9(2)17-14(19)12(24-16(17)25-13)8-10-4-6-11(7-5-10)18(21)22;/h4-8H,3H2,1-2H3;1H/q+1;/p-1/b12-8-; |
| InChIKey | HDUTUBSFSSJUDV-JCTPKUEWSA-M |
| XLogP | 0.22 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|