C20H16N2O6S — CID 135420250
ethyl 4-hydroxy-5-[(4-hydroxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate (PubChem CID 135420250) has the molecular formula C20H16N2O6S and a molecular weight of 412.42 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-[(4-hydroxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-5-[(4-hydroxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135420250 |
| Molecular Formula | C20H16N2O6S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | ethyl 4-hydroxy-5-[(4-hydroxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2ccc(O)cc2)S/C1=N\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16N2O6S/c1-2-28-20(25)17-18(24)16(11-12-3-9-15(23)10-4-12)29-19(17)21-13-5-7-14(8-6-13)22(26)27/h3-11,23-24H,2H2,1H3/b16-11?,21-19- |
| InChIKey | BIFJWSQURNAZCH-ZEKVHBHYSA-N |
| XLogP | 4.49 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|