C22H20N2O5S — CID 135508661
ethyl 5-[(4-ethylphenyl)methylidene]-4-hydroxy-2-(4-nitrophenyl)iminothiophene-3-carboxylate (PubChem CID 135508661) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is ethyl 5-[(4-ethylphenyl)methylidene]-4-hydroxy-2-(4-nitrophenyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl 5-[(4-ethylphenyl)methylidene]-4-hydroxy-2-(4-nitrophenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135508661 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | ethyl 5-[(4-ethylphenyl)methylidene]-4-hydroxy-2-(4-nitrophenyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2ccc(CC)cc2)S/C1=N\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-3-14-5-7-15(8-6-14)13-18-20(25)19(22(26)29-4-2)21(30-18)23-16-9-11-17(12-10-16)24(27)28/h5-13,25H,3-4H2,1-2H3/b18-13?,23-21- |
| InChIKey | KBDHZBUJDPDSHL-DGBSIKRBSA-N |
| XLogP | 5.35 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|