C21H18N2O7S — CID 135510394
ethyl 4-hydroxy-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate (PubChem CID 135510394) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135510394 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | ethyl 4-hydroxy-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-2-(4-nitrophenyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cccc(OC)c2O)S/C1=N\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N2O7S/c1-3-30-21(26)17-19(25)16(11-12-5-4-6-15(29-2)18(12)24)31-20(17)22-13-7-9-14(10-8-13)23(27)28/h4-11,24-25H,3H2,1-2H3/b16-11?,22-20- |
| InChIKey | IOEOYPPMAWULRR-LIDQHXHXSA-N |
| XLogP | 4.50 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|