C20H15FN2O5S — CID 135675095
ethyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-[(3-nitrophenyl)methylidene]thiophene-3-carboxylate (PubChem CID 135675095) has the molecular formula C20H15FN2O5S and a molecular weight of 414.41 g/mol. Its IUPAC name is ethyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-[(3-nitrophenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-[(3-nitrophenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135675095 |
| Molecular Formula | C20H15FN2O5S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | ethyl (5E)-2-(4-fluorophenyl)imino-4-hydroxy-5-[(3-nitrophenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C\c2cccc([N+](=O)[O-])c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN2O5S/c1-2-28-20(25)17-18(24)16(11-12-4-3-5-15(10-12)23(26)27)29-19(17)22-14-8-6-13(21)7-9-14/h3-11,24H,2H2,1H3/b16-11+,22-19- |
| InChIKey | HHNHMYWEBFMGEI-NZQUJZJYSA-N |
| XLogP | 4.93 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|