C19H15N3O5S — CID 135924753
ethyl (5E)-4-hydroxy-2-(3-nitrophenyl)imino-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate (PubChem CID 135924753) has the molecular formula C19H15N3O5S and a molecular weight of 397.41 g/mol. Its IUPAC name is ethyl (5E)-4-hydroxy-2-(3-nitrophenyl)imino-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate.
| Compound Name | ethyl (5E)-4-hydroxy-2-(3-nitrophenyl)imino-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135924753 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | ethyl (5E)-4-hydroxy-2-(3-nitrophenyl)imino-5-(pyridin-2-ylmethylidene)thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C\c2ccccn2)S/C1=N\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15N3O5S/c1-2-27-19(24)16-17(23)15(11-12-6-3-4-9-20-12)28-18(16)21-13-7-5-8-14(10-13)22(25)26/h3-11,23H,2H2,1H3/b15-11+,21-18- |
| InChIKey | HEUWBLDIKHWLNL-FMOFIACUSA-N |
| XLogP | 4.18 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|