C24H17ClN2O6S — CID 137120808
ethyl (5Z)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137120808) has the molecular formula C24H17ClN2O6S and a molecular weight of 496.93 g/mol. Its IUPAC name is ethyl (5Z)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137120808 |
| Molecular Formula | C24H17ClN2O6S |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | ethyl (5Z)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C24H17ClN2O6S/c1-2-32-24(29)21-22(28)20(34-23(21)26-14-6-4-3-5-7-14)13-16-9-11-19(33-16)17-12-15(27(30)31)8-10-18(17)25/h3-13,28H,2H2,1H3/b20-13-,26-23- |
| InChIKey | PSIBCLBKYVUAKR-MKIIFEJHSA-N |
| XLogP | 6.70 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|