C26H20N2O7S — CID 137170817
ethyl (5Z)-4-hydroxy-2-(2-methylbenzoyl)imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate (PubChem CID 137170817) has the molecular formula C26H20N2O7S and a molecular weight of 504.52 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-2-(2-methylbenzoyl)imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-2-(2-methylbenzoyl)imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170817 |
| Molecular Formula | C26H20N2O7S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-2-(2-methylbenzoyl)imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)S/C1=N\C(=O)c1ccccc1C |
| InChI | InChI=1S/C26H20N2O7S/c1-3-34-26(31)22-23(29)21(36-25(22)27-24(30)19-7-5-4-6-15(19)2)14-18-12-13-20(35-18)16-8-10-17(11-9-16)28(32)33/h4-14,29H,3H2,1-2H3/b21-14-,27-25- |
| InChIKey | QVDIKJQVYNDIPV-UUNHGKJBSA-N |
| XLogP | 5.87 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|