C25H18N2O7S — CID 135748897
ethyl (5E)-2-benzoylimino-4-hydroxy-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate (PubChem CID 135748897) has the molecular formula C25H18N2O7S and a molecular weight of 490.49 g/mol. Its IUPAC name is ethyl (5E)-2-benzoylimino-4-hydroxy-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5E)-2-benzoylimino-4-hydroxy-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135748897 |
| Molecular Formula | C25H18N2O7S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | ethyl (5E)-2-benzoylimino-4-hydroxy-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C\c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O7S/c1-2-33-25(30)21-22(28)20(35-24(21)26-23(29)16-6-4-3-5-7-16)14-18-12-13-19(34-18)15-8-10-17(11-9-15)27(31)32/h3-14,28H,2H2,1H3/b20-14+,26-24- |
| InChIKey | QKXJLVIEOXLGCE-LETHEXBRSA-N |
| XLogP | 5.56 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|