C25H18ClNO6S — CID 137120534
2-chloro-5-[5-[(Z)-(4-ethoxycarbonyl-3-hydroxy-5-phenyliminothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 137120534) has the molecular formula C25H18ClNO6S and a molecular weight of 495.94 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-(4-ethoxycarbonyl-3-hydroxy-5-phenyliminothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(Z)-(4-ethoxycarbonyl-3-hydroxy-5-phenyliminothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 137120534 |
| Molecular Formula | C25H18ClNO6S |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-(4-ethoxycarbonyl-3-hydroxy-5-phenyliminothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C25H18ClNO6S/c1-2-32-25(31)21-22(28)20(34-23(21)27-15-6-4-3-5-7-15)13-16-9-11-19(33-16)14-8-10-18(26)17(12-14)24(29)30/h3-13,28H,2H2,1H3,(H,29,30)/b20-13-,27-23- |
| InChIKey | AHPIPKRQNHYKGL-SLIQITBESA-N |
| XLogP | 6.49 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|