C24H22N2O8S — CID 137137964
ethyl (5Z)-5-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 137137964) has the molecular formula C24H22N2O8S and a molecular weight of 498.51 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137137964 |
| Molecular Formula | C24H22N2O8S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | ethyl (5Z)-5-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc([N+](=O)[O-])cc(OCC)c2O)S/C1=N\C(=O)c1ccccc1C |
| InChI | InChI=1S/C24H22N2O8S/c1-4-33-17-12-15(26(31)32)10-14(20(17)27)11-18-21(28)19(24(30)34-5-2)23(35-18)25-22(29)16-9-7-6-8-13(16)3/h6-12,27-28H,4-5H2,1-3H3/b18-11-,25-23- |
| InChIKey | SFAUNTQJXUHGRW-FMFHXUAGSA-N |
| XLogP | 4.71 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|