C13H9ClN2O3S2 — CID 50986628
(6E)-3-methyl-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one chloride (PubChem CID 50986628) has the molecular formula C13H9ClN2O3S2 and a molecular weight of 340.81 g/mol. Its IUPAC name is (6E)-3-methyl-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one chloride.
| Compound Name | (6E)-3-methyl-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one chloride |
|---|---|
| PubChem CID | 50986628 |
| Molecular Formula | C13H9ClN2O3S2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | (6E)-3-methyl-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one chloride |
| SMILES | Cc1csc2[n+]1C(=O)/C(=C\c1ccc([N+](=O)[O-])cc1)S2.[Cl-] |
| InChI | InChI=1S/C13H9N2O3S2.ClH/c1-8-7-19-13-14(8)12(16)11(20-13)6-9-2-4-10(5-3-9)15(17)18;/h2-7H,1H3;1H/q+1;/p-1/b11-6+; |
| InChIKey | ZWZLTMVNZSBOCE-ICSBZGNSSA-M |
| XLogP | 0.04 |
| TPSA | 64.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|