C18H11BrN3O5S2+ — CID 126957999
(6E)-3-(3-nitrophenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one;hydrobromide (PubChem CID 126957999) has the molecular formula C18H11BrN3O5S2+ and a molecular weight of 493.34 g/mol. Its IUPAC name is (6E)-3-(3-nitrophenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one;hydrobromide.
| Compound Name | (6E)-3-(3-nitrophenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one;hydrobromide |
|---|---|
| PubChem CID | 126957999 |
| Molecular Formula | C18H11BrN3O5S2+ |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 491.93 |
| IUPAC Name | (6E)-3-(3-nitrophenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one;hydrobromide |
| SMILES | Br.O=C1/C(=C\c2ccc([N+](=O)[O-])cc2)Sc2scc(-c3cccc([N+](=O)[O-])c3)[n+]21 |
| InChI | InChI=1S/C18H10N3O5S2.BrH/c22-17-16(8-11-4-6-13(7-5-11)20(23)24)28-18-19(17)15(10-27-18)12-2-1-3-14(9-12)21(25)26;/h1-10H;1H/q+1;/b16-8+; |
| InChIKey | PLRDIMYARYIEAC-OHGISNTKSA-N |
| XLogP | 4.88 |
| TPSA | 107.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|