C18H10Cl2N2O3S2 — CID 20842416
(6Z)-6-[(2,4-dichlorophenyl)methylidene]-3-[3-[hydroxy(oxido)amino]phenyl]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one (PubChem CID 20842416) has the molecular formula C18H10Cl2N2O3S2 and a molecular weight of 437.33 g/mol. Its IUPAC name is (6Z)-6-[(2,4-dichlorophenyl)methylidene]-3-[3-[hydroxy(oxido)amino]phenyl]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one.
| Compound Name | (6Z)-6-[(2,4-dichlorophenyl)methylidene]-3-[3-[hydroxy(oxido)amino]phenyl]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one |
|---|---|
| PubChem CID | 20842416 |
| Molecular Formula | C18H10Cl2N2O3S2 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | (6Z)-6-[(2,4-dichlorophenyl)methylidene]-3-[3-[hydroxy(oxido)amino]phenyl]-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium-5-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2Cl)Sc2scc(-c3cccc(N([O-])O)c3)[n+]21 |
| InChI | InChI=1S/C18H10Cl2N2O3S2/c19-12-5-4-10(14(20)8-12)7-16-17(23)21-15(9-26-18(21)27-16)11-2-1-3-13(6-11)22(24)25/h1-9,24H/b16-7- |
| InChIKey | JXLGCIDKJGGLRJ-APSNUPSMSA-N |
| XLogP | 5.49 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|