C17H15N5O5S2 — CID 136766432
ethyl 4-methyl-2-[2-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-1,3-thiazole-5-carboxylate (PubChem CID 136766432) has the molecular formula C17H15N5O5S2 and a molecular weight of 433.47 g/mol. Its IUPAC name is ethyl 4-methyl-2-[2-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[2-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 136766432 |
| Molecular Formula | C17H15N5O5S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | ethyl 4-methyl-2-[2-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NN=C2NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)S2)nc1C |
| InChI | InChI=1S/C17H15N5O5S2/c1-3-27-15(24)13-9(2)18-16(29-13)20-21-17-19-14(23)12(28-17)8-10-4-6-11(7-5-10)22(25)26/h4-8H,3H2,1-2H3,(H,18,20)(H,19,21,23)/b12-8+ |
| InChIKey | QTTBBTAPWAAFNE-XYOKQWHBSA-N |
| XLogP | 3.12 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|