C17H15N3O3S2 — CID 162666017
ethyl 2-[(E)-[(5Z)-5-benzylidene-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 162666017) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl 2-[(E)-[(5Z)-5-benzylidene-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(E)-[(5Z)-5-benzylidene-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 162666017 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 2-[(E)-[(5Z)-5-benzylidene-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(/N=C2\NC(=O)/C(=C/c3ccccc3)S2)nc1C |
| InChI | InChI=1S/C17H15N3O3S2/c1-3-23-15(22)13-10(2)18-16(25-13)20-17-19-14(21)12(24-17)9-11-7-5-4-6-8-11/h4-9H,3H2,1-2H3,(H,18,19,20,21)/b12-9- |
| InChIKey | XNCXGDNYSDDQKE-XFXZXTDPSA-N |
| XLogP | 3.52 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|