C20H18N4O3S2 — CID 155550874
ethyl 4-methyl-2-[(E)-[(5Z)-5-[(1-methylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazole-5-carboxylate (PubChem CID 155550874) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(E)-[(5Z)-5-[(1-methylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(E)-[(5Z)-5-[(1-methylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 155550874 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 4-methyl-2-[(E)-[(5Z)-5-[(1-methylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(/N=C2\NC(=O)/C(=C/c3cn(C)c4ccccc34)S2)nc1C |
| InChI | InChI=1S/C20H18N4O3S2/c1-4-27-18(26)16-11(2)21-19(29-16)23-20-22-17(25)15(28-20)9-12-10-24(3)14-8-6-5-7-13(12)14/h5-10H,4H2,1-3H3,(H,21,22,23,25)/b15-9- |
| InChIKey | WVSQFFRBDKJQKI-DHDCSXOGSA-N |
| XLogP | 4.01 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|