C16H11N5O4S — CID 135445084
N-[(E)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 135445084) has the molecular formula C16H11N5O4S and a molecular weight of 369.36 g/mol. Its IUPAC name is N-[(E)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135445084 |
| Molecular Formula | C16H11N5O4S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[(E)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C1N/C(=N\NC(=O)c2ccncc2)S/C1=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11N5O4S/c22-14(11-5-7-17-8-6-11)19-20-16-18-15(23)13(26-16)9-10-1-3-12(4-2-10)21(24)25/h1-9H,(H,19,22)(H,18,20,23)/b13-9+ |
| InChIKey | VMVZRUQWAYVCAJ-UKTHLTGXSA-N |
| XLogP | 1.89 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|