C26H23N5O5S — CID 135844812
N-[(Z)-[(5Z)-5-[[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 135844812) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is N-[(Z)-[(5Z)-5-[[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[(5Z)-5-[[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135844812 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-[(Z)-[(5Z)-5-[[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | COc1cc(/C=C2\S/C(=N\NC(=O)c3ccncc3)NC2=O)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H23N5O5S/c1-16-5-3-4-6-19(16)28-23(32)15-36-20-8-7-17(13-21(20)35-2)14-22-25(34)29-26(37-22)31-30-24(33)18-9-11-27-12-10-18/h3-14H,15H2,1-2H3,(H,28,32)(H,30,33)(H,29,31,34)/b22-14- |
| InChIKey | YTCYYWJPBUFHDU-HMAPJEAMSA-N |
| XLogP | 3.32 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|