C24H17BrClN5O4S — CID 136911730
N-[[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 136911730) has the molecular formula C24H17BrClN5O4S and a molecular weight of 586.86 g/mol. Its IUPAC name is N-[[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 136911730 |
| Molecular Formula | C24H17BrClN5O4S |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 584.99 |
| IUPAC Name | N-[[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(COc1ccc(Br)cc1/C=C1\SC(=NNC(=O)c2ccncc2)NC1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17BrClN5O4S/c25-16-1-6-19(35-13-21(32)28-18-4-2-17(26)3-5-18)15(11-16)12-20-23(34)29-24(36-20)31-30-22(33)14-7-9-27-10-8-14/h1-12H,13H2,(H,28,32)(H,30,33)(H,29,31,34)/b20-12- |
| InChIKey | SKEJQPYOBXKXGW-NDENLUEZSA-N |
| XLogP | 4.42 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|