C16H10Cl2N4O2S — CID 136522661
N-[(E)-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 136522661) has the molecular formula C16H10Cl2N4O2S and a molecular weight of 393.26 g/mol. Its IUPAC name is N-[(E)-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 136522661 |
| Molecular Formula | C16H10Cl2N4O2S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-[(E)-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C1N/C(=N\NC(=O)c2ccncc2)SC1=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H10Cl2N4O2S/c17-11-3-1-2-10(13(11)18)8-12-15(24)20-16(25-12)22-21-14(23)9-4-6-19-7-5-9/h1-8H,(H,21,23)(H,20,22,24) |
| InChIKey | WSZSDQCGZSAOAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|