C18H15IN2O3S — CID 2410370
(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 4-iodobenzoate (PubChem CID 2410370) has the molecular formula C18H15IN2O3S and a molecular weight of 466.30 g/mol. Its IUPAC name is (4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 4-iodobenzoate.
| Compound Name | (4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 4-iodobenzoate |
|---|---|
| PubChem CID | 2410370 |
| Molecular Formula | C18H15IN2O3S |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | (4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 4-iodobenzoate |
| SMILES | O=C(OCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H15IN2O3S/c19-11-7-5-10(6-8-11)18(23)24-9-14-20-16(22)15-12-3-1-2-4-13(12)25-17(15)21-14/h5-8H,1-4,9H2,(H,20,21,22) |
| InChIKey | UEADWINAHZIJGC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|