C20H20N2O6S — CID 8025635
(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2,4,5-trimethoxybenzoate (PubChem CID 8025635) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2,4,5-trimethoxybenzoate.
| Compound Name | (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8025635 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCc2nc3sc4c(c3c(=O)[nH]2)CCC4)cc1OC |
| InChI | InChI=1S/C20H20N2O6S/c1-25-12-8-14(27-3)13(26-2)7-11(12)20(24)28-9-16-21-18(23)17-10-5-4-6-15(10)29-19(17)22-16/h7-8H,4-6,9H2,1-3H3,(H,21,22,23) |
| InChIKey | PBRUWRXKWXYABU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |