C16H15FN4O3 — CID 2410779
2-(4-fluorophenoxy)ethyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 2410779) has the molecular formula C16H15FN4O3 and a molecular weight of 330.32 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 2410779 |
| Molecular Formula | C16H15FN4O3 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1cc(C)n2nc(C(=O)OCCOc3ccc(F)cc3)nc2n1 |
| InChI | InChI=1S/C16H15FN4O3/c1-10-9-11(2)21-16(18-10)19-14(20-21)15(22)24-8-7-23-13-5-3-12(17)4-6-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | QEZOFMXEINDWRD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|