C16H16N4O4 — CID 2551439
2-(4-methoxyphenoxy)ethyl 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 2551439) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 2551439 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COc1ccc(OCCOC(=O)c2nc3nccc(C)n3n2)cc1 |
| InChI | InChI=1S/C16H16N4O4/c1-11-7-8-17-16-18-14(19-20(11)16)15(21)24-10-9-23-13-5-3-12(22-2)4-6-13/h3-8H,9-10H2,1-2H3 |
| InChIKey | CZYARUXRHCOEKM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|