C24H44N4O2+2 — CID 2410840
1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[4-[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone (PubChem CID 2410840) has the molecular formula C24H44N4O2+2 and a molecular weight of 420.64 g/mol. Its IUPAC name is 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[4-[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone.
| Compound Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[4-[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone |
|---|---|
| PubChem CID | 2410840 |
| Molecular Formula | C24H44N4O2+2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-[4-[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)C[N+]23CC[N+](CC(=O)N4C[C@H](C)C[C@H](C)C4)(CC2)CC3)C1 |
| InChI | InChI=1S/C24H44N4O2/c1-19-11-20(2)14-25(13-19)23(29)17-27-5-8-28(9-6-27,10-7-27)18-24(30)26-15-21(3)12-22(4)16-26/h19-22H,5-18H2,1-4H3/q+2/t19-,20+,21-,22+,27?,28? |
| InChIKey | DSJCKQWXSCOIOJ-QSMRXADQSA-N |
| XLogP | 1.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|