C8H5Br2NO2S — CID 2410977
2-(2,5-dibromophenyl)sulfonylacetonitrile (PubChem CID 2410977) has the molecular formula C8H5Br2NO2S and a molecular weight of 339.01 g/mol. Its IUPAC name is 2-(2,5-dibromophenyl)sulfonylacetonitrile.
| Compound Name | 2-(2,5-dibromophenyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 2410977 |
| Molecular Formula | C8H5Br2NO2S |
| Molecular Weight | 339.01 g/mol |
| Exact Mass | 336.84 |
| IUPAC Name | 2-(2,5-dibromophenyl)sulfonylacetonitrile |
| SMILES | N#CCS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H5Br2NO2S/c9-6-1-2-7(10)8(5-6)14(12,13)4-3-11/h1-2,5H,4H2 |
| InChIKey | DBSWBTAIYOYELD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.01 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |