About prop-2-enyl 2-phenoxyacetate
prop-2-enyl 2-phenoxyacetate (PubChem CID 24117) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is prop-2-enyl 2-phenoxyacetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-phenoxyacetate |
| PubChem CID | 24117 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | prop-2-enyl 2-phenoxyacetate |
| SMILES | C=CCOC(=O)COc1ccccc1 |
| InChI | InChI=1S/C11H12O3/c1-2-8-13-11(12)9-14-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
| InChIKey | VUFZVGQUAVDKMC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-phenoxyacetate?
The IUPAC name of prop-2-enyl 2-phenoxyacetate (CID 24117) is prop-2-enyl 2-phenoxyacetate.
What is the SMILES notation for prop-2-enyl 2-phenoxyacetate?
The canonical SMILES for prop-2-enyl 2-phenoxyacetate is C=CCOC(=O)COc1ccccc1.
What is the InChIKey of prop-2-enyl 2-phenoxyacetate?
The InChIKey is VUFZVGQUAVDKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-2-8-13-11(12)9-14-10-6-4-3-5-7-10/h2-7H,1,8-9H2.
What are the key properties of prop-2-enyl 2-phenoxyacetate?
prop-2-enyl 2-phenoxyacetate has a molecular weight of 192.21 g/mol, XLogP of 1.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-phenoxyacetate is sourced from PubChem (CID 24117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).