C7H2ClN3O7 — CID 24126
2,4,6-trinitrobenzoyl chloride (PubChem CID 24126) has the molecular formula C7H2ClN3O7 and a molecular weight of 275.56 g/mol. Its IUPAC name is 2,4,6-trinitrobenzoyl chloride.
| Compound Name | 2,4,6-trinitrobenzoyl chloride |
|---|---|
| PubChem CID | 24126 |
| Molecular Formula | C7H2ClN3O7 |
| Molecular Weight | 275.56 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 2,4,6-trinitrobenzoyl chloride |
| SMILES | O=C(Cl)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H2ClN3O7/c8-7(12)6-4(10(15)16)1-3(9(13)14)2-5(6)11(17)18/h1-2H |
| InChIKey | MWGGWCCALVNFPN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 146.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|