C14H26ClNO2 — CID 24155
2-(1,4-dioxaspiro[4.6]undecan-3-yl)piperidin-1-ium chloride (PubChem CID 24155) has the molecular formula C14H26ClNO2 and a molecular weight of 275.82 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.6]undecan-3-yl)piperidin-1-ium chloride.
| Compound Name | 2-(1,4-dioxaspiro[4.6]undecan-3-yl)piperidin-1-ium chloride |
|---|---|
| PubChem CID | 24155 |
| Molecular Formula | C14H26ClNO2 |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.6]undecan-3-yl)piperidin-1-ium chloride |
| SMILES | C1CCCC2(CC1)OCC(C1CCCC[NH2+]1)O2.[Cl-] |
| InChI | InChI=1S/C14H25NO2.ClH/c1-2-5-9-14(8-4-1)16-11-13(17-14)12-7-3-6-10-15-12;/h12-13,15H,1-11H2;1H |
| InChIKey | CIMIDBQMXVBYFP-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |