C13H24ClNO2 — CID 24195
2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride (PubChem CID 24195) has the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride.
| Compound Name | 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride |
|---|---|
| PubChem CID | 24195 |
| Molecular Formula | C13H24ClNO2 |
| Molecular Weight | 261.79 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride |
| SMILES | C1CCC2(CC1)OCC(C1CCCC[NH2+]1)O2.[Cl-] |
| InChI | InChI=1S/C13H23NO2.ClH/c1-3-7-13(8-4-1)15-10-12(16-13)11-6-2-5-9-14-11;/h11-12,14H,1-10H2;1H |
| InChIKey | AXZOCQIHEMZCGO-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.79 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |