C13H23Cl2NO2 — CID 24157
2-(6-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride (PubChem CID 24157) has the molecular formula C13H23Cl2NO2 and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-(6-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride.
| Compound Name | 2-(6-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride |
|---|---|
| PubChem CID | 24157 |
| Molecular Formula | C13H23Cl2NO2 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(6-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidin-1-ium chloride |
| SMILES | ClC1CCCCC12OCC(C1CCCC[NH2+]1)O2.[Cl-] |
| InChI | InChI=1S/C13H22ClNO2.ClH/c14-12-6-1-3-7-13(12)16-9-11(17-13)10-5-2-4-8-15-10;/h10-12,15H,1-9H2;1H |
| InChIKey | OGSBFXFLMDXYIC-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|