C26H26F2N2O3S — CID 2415548
(3S)-N-(3,4-difluorophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 2415548) has the molecular formula C26H26F2N2O3S and a molecular weight of 484.57 g/mol. Its IUPAC name is (3S)-N-(3,4-difluorophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-N-(3,4-difluorophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 2415548 |
| Molecular Formula | C26H26F2N2O3S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (3S)-N-(3,4-difluorophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2Cc3ccccc3C[C@H]2C(=O)Nc2ccc(F)c(F)c2)c1C |
| InChI | InChI=1S/C26H26F2N2O3S/c1-15-11-16(2)18(4)25(17(15)3)34(32,33)30-14-20-8-6-5-7-19(20)12-24(30)26(31)29-21-9-10-22(27)23(28)13-21/h5-11,13,24H,12,14H2,1-4H3,(H,29,31)/t24-/m0/s1 |
| InChIKey | SRUCWIIWUAOSGK-DEOSSOPVSA-N |
| XLogP | 4.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |