C24H27N3O3S2 — CID 2418454
(3R)-N-(4-methyl-1,3-thiazol-2-yl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 2418454) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is (3R)-N-(4-methyl-1,3-thiazol-2-yl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-N-(4-methyl-1,3-thiazol-2-yl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 2418454 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3R)-N-(4-methyl-1,3-thiazol-2-yl)-2-(2,3,5,6-tetramethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | Cc1csc(NC(=O)[C@H]2Cc3ccccc3CN2S(=O)(=O)c2c(C)c(C)cc(C)c2C)n1 |
| InChI | InChI=1S/C24H27N3O3S2/c1-14-10-15(2)18(5)22(17(14)4)32(29,30)27-12-20-9-7-6-8-19(20)11-21(27)23(28)26-24-25-16(3)13-31-24/h6-10,13,21H,11-12H2,1-5H3,(H,25,26,28)/t21-/m1/s1 |
| InChIKey | DYYIALDWHFCKIH-OAQYLSRUSA-N |
| XLogP | 4.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |