C14H22N2O4 — CID 24187
5-(2-cyclohexyl-2-hydroxyethyl)-5-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 24187) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-(2-cyclohexyl-2-hydroxyethyl)-5-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-cyclohexyl-2-hydroxyethyl)-5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 24187 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 5-(2-cyclohexyl-2-hydroxyethyl)-5-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC(O)C2CCCCC2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C14H22N2O4/c1-2-14(11(18)15-13(20)16-12(14)19)8-10(17)9-6-4-3-5-7-9/h9-10,17H,2-8H2,1H3,(H2,15,16,18,19,20) |
| InChIKey | IVLKMPFIHGOSCI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|