C25H24N4O2S — CID 2419526
2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 2419526) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2419526 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(COc1ncnc2scc(-c3ccccc3)c12)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c30-22(28-19-9-11-20(12-10-19)29-13-5-2-6-14-29)15-31-24-23-21(18-7-3-1-4-8-18)16-32-25(23)27-17-26-24/h1,3-4,7-12,16-17H,2,5-6,13-15H2,(H,28,30) |
| InChIKey | NNYZTFCASCOEEJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|