C25H23FN4O2S — CID 30762194
2-[5-(4-fluorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 30762194) has the molecular formula C25H23FN4O2S and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 30762194 |
| Molecular Formula | C25H23FN4O2S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(Cn1cnc2scc(-c3ccc(F)cc3)c2c1=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H23FN4O2S/c26-18-6-4-17(5-7-18)21-15-33-24-23(21)25(32)30(16-27-24)14-22(31)28-19-8-10-20(11-9-19)29-12-2-1-3-13-29/h4-11,15-16H,1-3,12-14H2,(H,28,31) |
| InChIKey | OPQCARANNBEERM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|