C25H23ClN4O2S — CID 27928409
2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 27928409) has the molecular formula C25H23ClN4O2S and a molecular weight of 479.01 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 27928409 |
| Molecular Formula | C25H23ClN4O2S |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)Cn1cnc2scc(-c3ccc(Cl)cc3)c2c1=O |
| InChI | InChI=1S/C25H23ClN4O2S/c1-16-12-19(29-10-2-3-11-29)8-9-21(16)28-22(31)13-30-15-27-24-23(25(30)32)20(14-33-24)17-4-6-18(26)7-5-17/h4-9,12,14-15H,2-3,10-11,13H2,1H3,(H,28,31) |
| InChIKey | OPIIAPXZEJECIS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|