C26H26N2O5S — CID 2419595
ethyl 2,4-dimethyl-5-[2-(3-phenothiazin-10-ylpropanoyloxy)acetyl]-1H-pyrrole-3-carboxylate (PubChem CID 2419595) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[2-(3-phenothiazin-10-ylpropanoyloxy)acetyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[2-(3-phenothiazin-10-ylpropanoyloxy)acetyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2419595 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[2-(3-phenothiazin-10-ylpropanoyloxy)acetyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)COC(=O)CCN2c3ccccc3Sc3ccccc32)c1C |
| InChI | InChI=1S/C26H26N2O5S/c1-4-32-26(31)24-16(2)25(27-17(24)3)20(29)15-33-23(30)13-14-28-18-9-5-7-11-21(18)34-22-12-8-6-10-19(22)28/h5-12,27H,4,13-15H2,1-3H3 |
| InChIKey | DDQFQMNITRXRCR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|