About ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate
ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate (PubChem CID 142057273) has the molecular formula C18H20NO3PS
and a molecular weight of 361.40 g/mol. Its IUPAC name is ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate.
Molecular Properties
| Compound Name | ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate |
| PubChem CID | 142057273 |
| Molecular Formula | C18H20NO3PS |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate |
| SMILES | CCOPCOC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C18H20NO3PS/c1-2-22-23-13-21-18(20)11-12-19-14-7-3-5-9-16(14)24-17-10-6-4-8-15(17)19/h3-10,23H,2,11-13H2,1H3 |
| InChIKey | GRTLPNDXDQYLHB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate?
The IUPAC name of ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate (CID 142057273) is ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate.
What is the SMILES notation for ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate?
The canonical SMILES for ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate is CCOPCOC(=O)CCN1c2ccccc2Sc2ccccc21.
What is the InChIKey of ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate?
The InChIKey is GRTLPNDXDQYLHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20NO3PS/c1-2-22-23-13-21-18(20)11-12-19-14-7-3-5-9-16(14)24-17-10-6-4-8-15(17)19/h3-10,23H,2,11-13H2,1H3.
What are the key properties of ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate?
ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate has a molecular weight of 361.40 g/mol, XLogP of 4.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyphosphanylmethyl 3-phenothiazin-10-ylpropanoate is sourced from PubChem (CID 142057273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).