C22H20FN3O2 — CID 2422429
(2Z)-2-cyano-N-(2-fluorophenyl)-2-(2-oxo-1-pentylindol-3-ylidene)acetamide (PubChem CID 2422429) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is (2Z)-2-cyano-N-(2-fluorophenyl)-2-(2-oxo-1-pentylindol-3-ylidene)acetamide.
| Compound Name | (2Z)-2-cyano-N-(2-fluorophenyl)-2-(2-oxo-1-pentylindol-3-ylidene)acetamide |
|---|---|
| PubChem CID | 2422429 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (2Z)-2-cyano-N-(2-fluorophenyl)-2-(2-oxo-1-pentylindol-3-ylidene)acetamide |
| SMILES | CCCCCN1C(=O)/C(=C(/C#N)C(=O)Nc2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C22H20FN3O2/c1-2-3-8-13-26-19-12-7-4-9-15(19)20(22(26)28)16(14-24)21(27)25-18-11-6-5-10-17(18)23/h4-7,9-12H,2-3,8,13H2,1H3,(H,25,27)/b20-16- |
| InChIKey | AOKXMFXKPGYGMO-SILNSSARSA-N |
| XLogP | 4.28 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|