C19H18N3O6S3+ — CID 2425451
2-[(5Z)-5-[[4-(2-methyl-5-nitrophenyl)sulfonyloxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethylazanium (PubChem CID 2425451) has the molecular formula C19H18N3O6S3+ and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-(2-methyl-5-nitrophenyl)sulfonyloxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethylazanium.
| Compound Name | 2-[(5Z)-5-[[4-(2-methyl-5-nitrophenyl)sulfonyloxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethylazanium |
|---|---|
| PubChem CID | 2425451 |
| Molecular Formula | C19H18N3O6S3+ |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 2-[(5Z)-5-[[4-(2-methyl-5-nitrophenyl)sulfonyloxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethylazanium |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Oc1ccc(/C=C2\SC(=S)N(CC[NH3+])C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O6S3/c1-12-2-5-14(22(24)25)11-17(12)31(26,27)28-15-6-3-13(4-7-15)10-16-18(23)21(9-8-20)19(29)30-16/h2-7,10-11H,8-9,20H2,1H3/p+1/b16-10- |
| InChIKey | OYLZSTVQJTVOTQ-YBEGLDIGSA-O |
| XLogP | 2.11 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|