C20H16BrN3O7S2 — CID 2426387
[(2S)-1-(3-nitroanilino)-1-oxopropan-2-yl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate (PubChem CID 2426387) has the molecular formula C20H16BrN3O7S2 and a molecular weight of 554.40 g/mol. Its IUPAC name is [(2S)-1-(3-nitroanilino)-1-oxopropan-2-yl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate.
| Compound Name | [(2S)-1-(3-nitroanilino)-1-oxopropan-2-yl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2426387 |
| Molecular Formula | C20H16BrN3O7S2 |
| Molecular Weight | 554.40 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | [(2S)-1-(3-nitroanilino)-1-oxopropan-2-yl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(NS(=O)(=O)c2ccc(Br)s2)cc1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16BrN3O7S2/c1-12(19(25)22-15-3-2-4-16(11-15)24(27)28)31-20(26)13-5-7-14(8-6-13)23-33(29,30)18-10-9-17(21)32-18/h2-12,23H,1H3,(H,22,25)/t12-/m0/s1 |
| InChIKey | CZHMHFBIZFRAGB-LBPRGKRZSA-N |
| XLogP | 4.40 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|