C15H14N2O7 — CID 2428699
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2428699) has the molecular formula C15H14N2O7 and a molecular weight of 334.28 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2428699 |
| Molecular Formula | C15H14N2O7 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H14N2O7/c1-22-11-5-3-2-4-10(11)8-16-13(18)9-23-15(19)12-6-7-14(24-12)17(20)21/h2-7H,8-9H2,1H3,(H,16,18) |
| InChIKey | UBMVUXUDXAPYCI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|