C10H10N2O6 — CID 2689889
[2-oxo-2-(prop-2-enylamino)ethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2689889) has the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2689889 |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 5-nitrofuran-2-carboxylate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C10H10N2O6/c1-2-5-11-8(13)6-17-10(14)7-3-4-9(18-7)12(15)16/h2-4H,1,5-6H2,(H,11,13) |
| InChIKey | WHMNZIIOEOUTDE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|