C16H14N2O7 — CID 9454869
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 5-nitrofuran-2-carboxylate (PubChem CID 9454869) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454869 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 5-nitrofuran-2-carboxylate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc([N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C16H14N2O7/c1-2-14(20)17-11-5-3-10(4-6-11)12(19)9-24-16(21)13-7-8-15(25-13)18(22)23/h3-8H,2,9H2,1H3,(H,17,20) |
| InChIKey | TUQLNKRRMKHUJZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|