C13H7F2NO6 — CID 2619822
[2-(3,4-difluorophenyl)-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2619822) has the molecular formula C13H7F2NO6 and a molecular weight of 311.20 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2619822 |
| Molecular Formula | C13H7F2NO6 |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])o1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H7F2NO6/c14-8-2-1-7(5-9(8)15)10(17)6-21-13(18)11-3-4-12(22-11)16(19)20/h1-5H,6H2 |
| InChIKey | GAHUZFRXMFZYAM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|